C14H25NO4 — CID 101489636
tert-butyl (4S)-4-[(E,1R)-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate (PubChem CID 101489636) has the molecular formula C14H25NO4 and a molecular weight of 271.36 g/mol. Its IUPAC name is tert-butyl (4S)-4-[(E,1R)-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate.
| Compound Name | tert-butyl (4S)-4-[(E,1R)-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
|---|---|
| PubChem CID | 101489636 |
| Molecular Formula | C14H25NO4 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.18 |
| IUPAC Name | tert-butyl (4S)-4-[(E,1R)-1-hydroxybut-2-enyl]-2,2-dimethyl-1,3-oxazolidine-3-carboxylate |
| SMILES | C/C=C/[C@@H](O)[C@@H]1COC(C)(C)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H25NO4/c1-7-8-11(16)10-9-18-14(5,6)15(10)12(17)19-13(2,3)4/h7-8,10-11,16H,9H2,1-6H3/b8-7+/t10-,11+/m0/s1 |
| InChIKey | KSOFNBWVFINBSK-IAYMVZNDSA-N |
| XLogP | 2.30 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|