About (1R,3S)-cyclopent-4-ene-1,3-diol
(1R,3S)-cyclopent-4-ene-1,3-diol (PubChem CID 10148988) has the molecular formula C5H8O2
and a molecular weight of 100.12 g/mol. Its IUPAC name is (1R,3S)-cyclopent-4-ene-1,3-diol.
Molecular Properties
| Compound Name | (1R,3S)-cyclopent-4-ene-1,3-diol |
| PubChem CID | 10148988 |
| Molecular Formula | C5H8O2 |
| Molecular Weight | 100.12 g/mol |
| Exact Mass | 100.05 |
| IUPAC Name | (1R,3S)-cyclopent-4-ene-1,3-diol |
| SMILES | O[C@@H]1C=C[C@H](O)C1 |
| InChI | InChI=1S/C5H8O2/c6-4-1-2-5(7)3-4/h1-2,4-7H,3H2/t4-,5+ |
| InChIKey | IGRLIBJHDBWKNA-SYDPRGILSA-N |
| XLogP | -0.33 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 100.12 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1R,3S)-cyclopent-4-ene-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,3S)-cyclopent-4-ene-1,3-diol?
The IUPAC name of (1R,3S)-cyclopent-4-ene-1,3-diol (CID 10148988) is (1R,3S)-cyclopent-4-ene-1,3-diol.
What is the SMILES notation for (1R,3S)-cyclopent-4-ene-1,3-diol?
The canonical SMILES for (1R,3S)-cyclopent-4-ene-1,3-diol is O[C@@H]1C=C[C@H](O)C1.
What is the InChIKey of (1R,3S)-cyclopent-4-ene-1,3-diol?
The InChIKey is IGRLIBJHDBWKNA-SYDPRGILSA-N. The full InChI is InChI=1S/C5H8O2/c6-4-1-2-5(7)3-4/h1-2,4-7H,3H2/t4-,5+.
What are the key properties of (1R,3S)-cyclopent-4-ene-1,3-diol?
(1R,3S)-cyclopent-4-ene-1,3-diol has a molecular weight of 100.12 g/mol, XLogP of -0.33, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,3S)-cyclopent-4-ene-1,3-diol is sourced from PubChem (CID 10148988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).