C30H27N3O10S — CID 101489913
dimethyl (1R,11S)-12-[(4-methoxyphenyl)methyl]-9-(2-nitrophenyl)sulfonyl-13-oxa-9,12-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15,15-dicarboxylate (PubChem CID 101489913) has the molecular formula C30H27N3O10S and a molecular weight of 621.62 g/mol. Its IUPAC name is dimethyl (1R,11S)-12-[(4-methoxyphenyl)methyl]-9-(2-nitrophenyl)sulfonyl-13-oxa-9,12-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15,15-dicarboxylate.
| Compound Name | dimethyl (1R,11S)-12-[(4-methoxyphenyl)methyl]-9-(2-nitrophenyl)sulfonyl-13-oxa-9,12-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15,15-dicarboxylate |
|---|---|
| PubChem CID | 101489913 |
| Molecular Formula | C30H27N3O10S |
| Molecular Weight | 621.62 g/mol |
| Exact Mass | 621.14 |
| IUPAC Name | dimethyl (1R,11S)-12-[(4-methoxyphenyl)methyl]-9-(2-nitrophenyl)sulfonyl-13-oxa-9,12-diazatetracyclo[9.2.2.02,10.03,8]pentadeca-2(10),3,5,7-tetraene-15,15-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@H]2ON(Cc3ccc(OC)cc3)[C@@H]1c1c2c2ccccc2n1S(=O)(=O)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C30H27N3O10S/c1-40-19-14-12-18(13-15-19)17-31-27-26-25(23(43-31)16-30(27,28(34)41-2)29(35)42-3)20-8-4-5-9-21(20)32(26)44(38,39)24-11-7-6-10-22(24)33(36)37/h4-15,23,27H,16-17H2,1-3H3/t23-,27-/m1/s1 |
| InChIKey | LDDJUBUMYABLPV-YIXXDRMTSA-N |
| XLogP | 4.06 |
| TPSA | 156.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.62 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|