About 2-methoxypyridine-3,4-diamine
2-methoxypyridine-3,4-diamine (PubChem CID 10148998) has the molecular formula C6H9N3O
and a molecular weight of 139.16 g/mol. Its IUPAC name is 2-methoxypyridine-3,4-diamine.
Molecular Properties
| Compound Name | 2-methoxypyridine-3,4-diamine |
| PubChem CID | 10148998 |
| Molecular Formula | C6H9N3O |
| Molecular Weight | 139.16 g/mol |
| Exact Mass | 139.07 |
| IUPAC Name | 2-methoxypyridine-3,4-diamine |
| SMILES | COc1nccc(N)c1N |
| InChI | InChI=1S/C6H9N3O/c1-10-6-5(8)4(7)2-3-9-6/h2-3H,8H2,1H3,(H2,7,9) |
| InChIKey | YAIFNSSQKVRCSO-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 139.16 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-methoxypyridine-3,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methoxypyridine-3,4-diamine?
The IUPAC name of 2-methoxypyridine-3,4-diamine (CID 10148998) is 2-methoxypyridine-3,4-diamine.
What is the SMILES notation for 2-methoxypyridine-3,4-diamine?
The canonical SMILES for 2-methoxypyridine-3,4-diamine is COc1nccc(N)c1N.
What is the InChIKey of 2-methoxypyridine-3,4-diamine?
The InChIKey is YAIFNSSQKVRCSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9N3O/c1-10-6-5(8)4(7)2-3-9-6/h2-3H,8H2,1H3,(H2,7,9).
What are the key properties of 2-methoxypyridine-3,4-diamine?
2-methoxypyridine-3,4-diamine has a molecular weight of 139.16 g/mol, XLogP of 0.25, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methoxypyridine-3,4-diamine is sourced from PubChem (CID 10148998), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).