C16H21N5 — CID 101490032
4-N-(2-methylphenyl)-2-piperidin-1-ylpyrimidine-4,6-diamine (PubChem CID 101490032) has the molecular formula C16H21N5 and a molecular weight of 283.38 g/mol. Its IUPAC name is 4-N-(2-methylphenyl)-2-piperidin-1-ylpyrimidine-4,6-diamine.
| Compound Name | 4-N-(2-methylphenyl)-2-piperidin-1-ylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 101490032 |
| Molecular Formula | C16H21N5 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.18 |
| IUPAC Name | 4-N-(2-methylphenyl)-2-piperidin-1-ylpyrimidine-4,6-diamine |
| SMILES | Cc1ccccc1Nc1cc(N)nc(N2CCCCC2)n1 |
| InChI | InChI=1S/C16H21N5/c1-12-7-3-4-8-13(12)18-15-11-14(17)19-16(20-15)21-9-5-2-6-10-21/h3-4,7-8,11H,2,5-6,9-10H2,1H3,(H3,17,18,19,20) |
| InChIKey | KBXUMUCBGGGZIA-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |