C19H34O5Si — CID 101490072
[(3aS,6S,6aS)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101490072) has the molecular formula C19H34O5Si and a molecular weight of 370.56 g/mol. Its IUPAC name is [(3aS,6S,6aS)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,6S,6aS)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101490072 |
| Molecular Formula | C19H34O5Si |
| Molecular Weight | 370.56 g/mol |
| Exact Mass | 370.22 |
| IUPAC Name | [(3aS,6S,6aS)-4-(2,2-dimethyl-1,3-dioxolan-4-yl)-2,2-dimethyl-6,6a-dihydro-3aH-cyclopenta[d][1,3]dioxol-6-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC1(C)OCC(C2=C[C@H](O[Si](C)(C)C(C)(C)C)[C@H]3OC(C)(C)O[C@@H]23)O1 |
| InChI | InChI=1S/C19H34O5Si/c1-17(2,3)25(8,9)24-13-10-12(14-11-20-18(4,5)21-14)15-16(13)23-19(6,7)22-15/h10,13-16H,11H2,1-9H3/t13-,14?,15-,16+/m0/s1 |
| InChIKey | FRMGREDLYVAMKP-HNSVSWJLSA-N |
| XLogP | 3.99 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.56 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|