About spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one
spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one (PubChem CID 101490348) has the molecular formula C11H11NO3
and a molecular weight of 205.21 g/mol. Its IUPAC name is spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one.
Molecular Properties
| Compound Name | spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one |
| PubChem CID | 101490348 |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one |
| SMILES | O=C1OC2(CCCCO2)c2ncccc21 |
| InChI | InChI=1S/C11H11NO3/c13-10-8-4-3-6-12-9(8)11(15-10)5-1-2-7-14-11/h3-4,6H,1-2,5,7H2 |
| InChIKey | LUKGRFQAIGLRSV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one?
The IUPAC name of spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one (CID 101490348) is spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one.
What is the SMILES notation for spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one?
The canonical SMILES for spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one is O=C1OC2(CCCCO2)c2ncccc21.
What is the InChIKey of spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one?
The InChIKey is LUKGRFQAIGLRSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3/c13-10-8-4-3-6-12-9(8)11(15-10)5-1-2-7-14-11/h3-4,6H,1-2,5,7H2.
What are the key properties of spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one?
spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one has a molecular weight of 205.21 g/mol, XLogP of 1.61, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[furo[3,4-b]pyridine-7,2'-oxane]-5-one is sourced from PubChem (CID 101490348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).