C31H64O4Si2 — CID 101490413
(E,5R,6R,7S,8R,9S,10S)-5-hydroxy-2,6,8,10,12-pentamethyl-7,9-bis(triethylsilyloxy)tetradec-12-en-3-one (PubChem CID 101490413) has the molecular formula C31H64O4Si2 and a molecular weight of 557.02 g/mol. Its IUPAC name is (E,5R,6R,7S,8R,9S,10S)-5-hydroxy-2,6,8,10,12-pentamethyl-7,9-bis(triethylsilyloxy)tetradec-12-en-3-one.
| Compound Name | (E,5R,6R,7S,8R,9S,10S)-5-hydroxy-2,6,8,10,12-pentamethyl-7,9-bis(triethylsilyloxy)tetradec-12-en-3-one |
|---|---|
| PubChem CID | 101490413 |
| Molecular Formula | C31H64O4Si2 |
| Molecular Weight | 557.02 g/mol |
| Exact Mass | 556.43 |
| IUPAC Name | (E,5R,6R,7S,8R,9S,10S)-5-hydroxy-2,6,8,10,12-pentamethyl-7,9-bis(triethylsilyloxy)tetradec-12-en-3-one |
| SMILES | C/C=C(\C)C[C@H](C)[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@@H](O[Si](CC)(CC)CC)[C@H](C)[C@H](O)CC(=O)C(C)C |
| InChI | InChI=1S/C31H64O4Si2/c1-14-24(10)21-25(11)30(34-36(15-2,16-3)17-4)27(13)31(35-37(18-5,19-6)20-7)26(12)29(33)22-28(32)23(8)9/h14,23,25-27,29-31,33H,15-22H2,1-13H3/b24-14+/t25-,26+,27+,29+,30-,31-/m0/s1 |
| InChIKey | SOWUZMBKRHKGOK-CMTHKRBNSA-N |
| XLogP | 9.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.02 |
| LogP ≤ 5 | 9.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|