C23H28N2O4 — CID 101490584
(2S,3R,4R,5Z)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(2-phenylethylamino)-5-(pyridin-3-ylmethylidene)oxolan-3-ol (PubChem CID 101490584) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is (2S,3R,4R,5Z)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(2-phenylethylamino)-5-(pyridin-3-ylmethylidene)oxolan-3-ol.
| Compound Name | (2S,3R,4R,5Z)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(2-phenylethylamino)-5-(pyridin-3-ylmethylidene)oxolan-3-ol |
|---|---|
| PubChem CID | 101490584 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | (2S,3R,4R,5Z)-2-(2,2-dimethyl-1,3-dioxolan-4-yl)-4-(2-phenylethylamino)-5-(pyridin-3-ylmethylidene)oxolan-3-ol |
| SMILES | CC1(C)OCC([C@H]2O/C(=C\c3cccnc3)[C@H](NCCc3ccccc3)[C@H]2O)O1 |
| InChI | InChI=1S/C23H28N2O4/c1-23(2)27-15-19(29-23)22-21(26)20(25-12-10-16-7-4-3-5-8-16)18(28-22)13-17-9-6-11-24-14-17/h3-9,11,13-14,19-22,25-26H,10,12,15H2,1-2H3/b18-13-/t19?,20-,21+,22+/m0/s1 |
| InChIKey | KLVYWEHADGFXBX-PZYLZVOKSA-N |
| XLogP | 2.53 |
| TPSA | 72.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |