C17H15Cl2NOS — CID 101490656
(3S,5S,7aR)-3,5-bis(4-chlorophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazole (PubChem CID 101490656) has the molecular formula C17H15Cl2NOS and a molecular weight of 352.29 g/mol. Its IUPAC name is (3S,5S,7aR)-3,5-bis(4-chlorophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazole.
| Compound Name | (3S,5S,7aR)-3,5-bis(4-chlorophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazole |
|---|---|
| PubChem CID | 101490656 |
| Molecular Formula | C17H15Cl2NOS |
| Molecular Weight | 352.29 g/mol |
| Exact Mass | 351.03 |
| IUPAC Name | (3S,5S,7aR)-3,5-bis(4-chlorophenyl)-3,5,7,7a-tetrahydro-1H-[1,3]thiazolo[3,4-c][1,3]oxazole |
| SMILES | Clc1ccc([C@@H]2OC[C@@H]3CS[C@@H](c4ccc(Cl)cc4)N32)cc1 |
| InChI | InChI=1S/C17H15Cl2NOS/c18-13-5-1-11(2-6-13)16-20-15(9-21-16)10-22-17(20)12-3-7-14(19)8-4-12/h1-8,15-17H,9-10H2/t15-,16+,17+/m1/s1 |
| InChIKey | YTFXWRPJZBKKFW-IKGGRYGDSA-N |
| XLogP | 5.14 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.29 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |