C12H23NO10 — CID 101491035
(1R,2R,3S,4S,5S,6R)-5-amino-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexane-1,2,3,4-tetrol (PubChem CID 101491035) has the molecular formula C12H23NO10 and a molecular weight of 341.31 g/mol. Its IUPAC name is (1R,2R,3S,4S,5S,6R)-5-amino-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexane-1,2,3,4-tetrol.
| Compound Name | (1R,2R,3S,4S,5S,6R)-5-amino-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexane-1,2,3,4-tetrol |
|---|---|
| PubChem CID | 101491035 |
| Molecular Formula | C12H23NO10 |
| Molecular Weight | 341.31 g/mol |
| Exact Mass | 341.13 |
| IUPAC Name | (1R,2R,3S,4S,5S,6R)-5-amino-6-[(2R,3R,4S,5R,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxycyclohexane-1,2,3,4-tetrol |
| SMILES | N[C@H]1[C@H](O)[C@H](O)[C@@H](O)[C@@H](O)[C@@H]1O[C@@H]1O[C@H](CO)[C@H](O)[C@H](O)[C@H]1O |
| InChI | InChI=1S/C12H23NO10/c13-3-5(16)7(18)8(19)9(20)11(3)23-12-10(21)6(17)4(15)2(1-14)22-12/h2-12,14-21H,1,13H2/t2-,3+,4+,5+,6+,7+,8-,9-,10-,11-,12+/m1/s1 |
| InChIKey | NGTHUUQTUCAHNE-ZGROBUEHSA-N |
| XLogP | -6.04 |
| TPSA | 206.32 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.31 |
| LogP ≤ 5 | -6.04 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 11 |