C21H38O4Si — CID 101491500
methyl 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclopenten-1-yl]octanoate (PubChem CID 101491500) has the molecular formula C21H38O4Si and a molecular weight of 382.62 g/mol. Its IUPAC name is methyl 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclopenten-1-yl]octanoate.
| Compound Name | methyl 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclopenten-1-yl]octanoate |
|---|---|
| PubChem CID | 101491500 |
| Molecular Formula | C21H38O4Si |
| Molecular Weight | 382.62 g/mol |
| Exact Mass | 382.25 |
| IUPAC Name | methyl 8-[2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-oxocyclopenten-1-yl]octanoate |
| SMILES | COC(=O)CCCCCCCC1=C(CO[Si](C)(C)C(C)(C)C)CCC1=O |
| InChI | InChI=1S/C21H38O4Si/c1-21(2,3)26(5,6)25-16-17-14-15-19(22)18(17)12-10-8-7-9-11-13-20(23)24-4/h7-16H2,1-6H3 |
| InChIKey | VXHSHIPWFOMINZ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.62 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|