C15H13N3 — CID 10149166
15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10(17),11,13-heptaen-6-amine (PubChem CID 10149166) has the molecular formula C15H13N3 and a molecular weight of 235.29 g/mol. Its IUPAC name is 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10(17),11,13-heptaen-6-amine.
| Compound Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10(17),11,13-heptaen-6-amine |
|---|---|
| PubChem CID | 10149166 |
| Molecular Formula | C15H13N3 |
| Molecular Weight | 235.29 g/mol |
| Exact Mass | 235.11 |
| IUPAC Name | 15,16-diazatetracyclo[8.6.1.02,7.014,17]heptadeca-1(16),2(7),3,5,10(17),11,13-heptaen-6-amine |
| SMILES | Nc1cccc2c1CCc1cccc3[nH]nc-2c13 |
| InChI | InChI=1S/C15H13N3/c16-12-5-2-4-11-10(12)8-7-9-3-1-6-13-14(9)15(11)18-17-13/h1-6H,7-8,16H2,(H,17,18) |
| InChIKey | ZRVCWUIUKXJJIC-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.29 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|