C18H32O2 — CID 101491763
1-[(2R,6R)-6-heptyl-3,6-dihydro-2H-pyran-2-yl]-3,3-dimethylbutan-2-one (PubChem CID 101491763) has the molecular formula C18H32O2 and a molecular weight of 280.45 g/mol. Its IUPAC name is 1-[(2R,6R)-6-heptyl-3,6-dihydro-2H-pyran-2-yl]-3,3-dimethylbutan-2-one.
| Compound Name | 1-[(2R,6R)-6-heptyl-3,6-dihydro-2H-pyran-2-yl]-3,3-dimethylbutan-2-one |
|---|---|
| PubChem CID | 101491763 |
| Molecular Formula | C18H32O2 |
| Molecular Weight | 280.45 g/mol |
| Exact Mass | 280.24 |
| IUPAC Name | 1-[(2R,6R)-6-heptyl-3,6-dihydro-2H-pyran-2-yl]-3,3-dimethylbutan-2-one |
| SMILES | CCCCCCC[C@@H]1C=CC[C@H](CC(=O)C(C)(C)C)O1 |
| InChI | InChI=1S/C18H32O2/c1-5-6-7-8-9-11-15-12-10-13-16(20-15)14-17(19)18(2,3)4/h10,12,15-16H,5-9,11,13-14H2,1-4H3/t15-,16-/m1/s1 |
| InChIKey | CUQUQOAGQIJBSM-HZPDHXFCSA-N |
| XLogP | 5.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.45 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|