C16H31N — CID 10149177
2-(1,3,3,5,5-pentamethylcyclohexyl)pent-4-en-1-amine (PubChem CID 10149177) has the molecular formula C16H31N and a molecular weight of 237.43 g/mol. Its IUPAC name is 2-(1,3,3,5,5-pentamethylcyclohexyl)pent-4-en-1-amine.
| Compound Name | 2-(1,3,3,5,5-pentamethylcyclohexyl)pent-4-en-1-amine |
|---|---|
| PubChem CID | 10149177 |
| Molecular Formula | C16H31N |
| Molecular Weight | 237.43 g/mol |
| Exact Mass | 237.25 |
| IUPAC Name | 2-(1,3,3,5,5-pentamethylcyclohexyl)pent-4-en-1-amine |
| SMILES | C=CCC(CN)C1(C)CC(C)(C)CC(C)(C)C1 |
| InChI | InChI=1S/C16H31N/c1-7-8-13(9-17)16(6)11-14(2,3)10-15(4,5)12-16/h7,13H,1,8-12,17H2,2-6H3 |
| InChIKey | DJRPMKGSJCBLJU-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.43 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|