About [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate
[(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate (PubChem CID 101491940) has the molecular formula C13H19NO4
and a molecular weight of 253.30 g/mol. Its IUPAC name is [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate.
Molecular Properties
| Compound Name | [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate |
| PubChem CID | 101491940 |
| Molecular Formula | C13H19NO4 |
| Molecular Weight | 253.30 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate |
| SMILES | C=C(CCC/C=C/CN1CCOC1=O)OC(C)=O |
| InChI | InChI=1S/C13H19NO4/c1-11(18-12(2)15)7-5-3-4-6-8-14-9-10-17-13(14)16/h4,6H,1,3,5,7-10H2,2H3/b6-4+ |
| InChIKey | AXGMPJFRKNNGKD-GQCTYLIASA-N |
| XLogP | 2.24 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 253.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate?
The IUPAC name of [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate (CID 101491940) is [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate.
What is the SMILES notation for [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate?
The canonical SMILES for [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate is C=C(CCC/C=C/CN1CCOC1=O)OC(C)=O.
What is the InChIKey of [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate?
The InChIKey is AXGMPJFRKNNGKD-GQCTYLIASA-N. The full InChI is InChI=1S/C13H19NO4/c1-11(18-12(2)15)7-5-3-4-6-8-14-9-10-17-13(14)16/h4,6H,1,3,5,7-10H2,2H3/b6-4+.
What are the key properties of [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate?
[(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate has a molecular weight of 253.30 g/mol, XLogP of 2.24, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(6E)-8-(2-oxo-1,3-oxazolidin-3-yl)octa-1,6-dien-2-yl] acetate is sourced from PubChem (CID 101491940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).