C28H21F3N3OP — CID 101492229
1,2-diphenyl-3-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]-5,6-dihydro-4H-cyclopenta[c]phosphole 2-oxide (PubChem CID 101492229) has the molecular formula C28H21F3N3OP and a molecular weight of 503.46 g/mol. Its IUPAC name is 1,2-diphenyl-3-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]-5,6-dihydro-4H-cyclopenta[c]phosphole 2-oxide.
| Compound Name | 1,2-diphenyl-3-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]-5,6-dihydro-4H-cyclopenta[c]phosphole 2-oxide |
|---|---|
| PubChem CID | 101492229 |
| Molecular Formula | C28H21F3N3OP |
| Molecular Weight | 503.46 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | 1,2-diphenyl-3-[1-[4-(trifluoromethyl)phenyl]triazol-4-yl]-5,6-dihydro-4H-cyclopenta[c]phosphole 2-oxide |
| SMILES | O=P1(c2ccccc2)C(c2ccccc2)=C2CCCC2=C1c1cn(-c2ccc(C(F)(F)F)cc2)nn1 |
| InChI | InChI=1S/C28H21F3N3OP/c29-28(30,31)20-14-16-21(17-15-20)34-18-25(32-33-34)27-24-13-7-12-23(24)26(19-8-3-1-4-9-19)36(27,35)22-10-5-2-6-11-22/h1-6,8-11,14-18H,7,12-13H2 |
| InChIKey | MVQMDTAYLUTAIM-UHFFFAOYSA-N |
| XLogP | 7.29 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.46 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|