C28H12F12S2 — CID 101492289
2,2,3,3,5,6,8,8,9,9,15,16-dodecafluoro-11,13-bis(phenylsulfanyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene (PubChem CID 101492289) has the molecular formula C28H12F12S2 and a molecular weight of 640.51 g/mol. Its IUPAC name is 2,2,3,3,5,6,8,8,9,9,15,16-dodecafluoro-11,13-bis(phenylsulfanyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene.
| Compound Name | 2,2,3,3,5,6,8,8,9,9,15,16-dodecafluoro-11,13-bis(phenylsulfanyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene |
|---|---|
| PubChem CID | 101492289 |
| Molecular Formula | C28H12F12S2 |
| Molecular Weight | 640.51 g/mol |
| Exact Mass | 640.02 |
| IUPAC Name | 2,2,3,3,5,6,8,8,9,9,15,16-dodecafluoro-11,13-bis(phenylsulfanyl)tricyclo[8.2.2.24,7]hexadeca-1(12),4(16),5,7(15),10,13-hexaene |
| SMILES | Fc1c(F)c2c(F)c(F)c1C(F)(F)C(F)(F)c1cc(Sc3ccccc3)c(cc1Sc1ccccc1)C(F)(F)C2(F)F |
| InChI | InChI=1S/C28H12F12S2/c29-21-19-22(30)24(32)20(23(21)31)28(39,40)26(35,36)16-11-17(41-13-7-3-1-4-8-13)15(25(33,34)27(19,37)38)12-18(16)42-14-9-5-2-6-10-14/h1-12H |
| InChIKey | CPPAOUUMTXALIH-UHFFFAOYSA-N |
| XLogP | 10.63 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.51 |
| LogP ≤ 5 | 10.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|