About methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate
methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate (PubChem CID 101492332) has the molecular formula C24H25NO4
and a molecular weight of 391.47 g/mol. Its IUPAC name is methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate.
Molecular Properties
| Compound Name | methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate |
| PubChem CID | 101492332 |
| Molecular Formula | C24H25NO4 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate |
| SMILES | C=C[C@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccc(/C=C/CCC(=O)OC)cc1 |
| InChI | InChI=1S/C24H25NO4/c1-4-21-23(25(24(21)27)19-13-15-20(28-2)16-14-19)18-11-9-17(10-12-18)7-5-6-8-22(26)29-3/h4-5,7,9-16,21,23H,1,6,8H2,2-3H3/b7-5+/t21-,23-/m1/s1 |
| InChIKey | HPLHXVWFCZPYGX-QAMVVPEXSA-N |
| XLogP | 4.55 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate?
The IUPAC name of methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate (CID 101492332) is methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate.
What is the SMILES notation for methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate?
The canonical SMILES for methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate is C=C[C@H]1C(=O)N(c2ccc(OC)cc2)[C@@H]1c1ccc(/C=C/CCC(=O)OC)cc1.
What is the InChIKey of methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate?
The InChIKey is HPLHXVWFCZPYGX-QAMVVPEXSA-N. The full InChI is InChI=1S/C24H25NO4/c1-4-21-23(25(24(21)27)19-13-15-20(28-2)16-14-19)18-11-9-17(10-12-18)7-5-6-8-22(26)29-3/h4-5,7,9-16,21,23H,1,6,8H2,2-3H3/b7-5+/t21-,23-/m1/s1.
What are the key properties of methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate?
methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate has a molecular weight of 391.47 g/mol, XLogP of 4.55, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (E)-5-[4-[(2S,3R)-3-ethenyl-1-(4-methoxyphenyl)-4-oxoazetidin-2-yl]phenyl]pent-4-enoate is sourced from PubChem (CID 101492332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).