C11H9BrFNO2S — CID 101492425
3-[(2R)-2-(4-bromophenyl)-2-fluoroacetyl]-1,3-thiazolidin-2-one (PubChem CID 101492425) has the molecular formula C11H9BrFNO2S and a molecular weight of 318.17 g/mol. Its IUPAC name is 3-[(2R)-2-(4-bromophenyl)-2-fluoroacetyl]-1,3-thiazolidin-2-one.
| Compound Name | 3-[(2R)-2-(4-bromophenyl)-2-fluoroacetyl]-1,3-thiazolidin-2-one |
|---|---|
| PubChem CID | 101492425 |
| Molecular Formula | C11H9BrFNO2S |
| Molecular Weight | 318.17 g/mol |
| Exact Mass | 316.95 |
| IUPAC Name | 3-[(2R)-2-(4-bromophenyl)-2-fluoroacetyl]-1,3-thiazolidin-2-one |
| SMILES | O=C1SCCN1C(=O)[C@H](F)c1ccc(Br)cc1 |
| InChI | InChI=1S/C11H9BrFNO2S/c12-8-3-1-7(2-4-8)9(13)10(15)14-5-6-17-11(14)16/h1-4,9H,5-6H2/t9-/m1/s1 |
| InChIKey | UINHQSZLFFQEHY-SECBINFHSA-N |
| XLogP | 3.16 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.17 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|