C19H28O6 — CID 101492834
ethyl (E,5S)-5-(methoxymethoxy)-7-[4-(methoxymethoxy)phenyl]hept-2-enoate (PubChem CID 101492834) has the molecular formula C19H28O6 and a molecular weight of 352.43 g/mol. Its IUPAC name is ethyl (E,5S)-5-(methoxymethoxy)-7-[4-(methoxymethoxy)phenyl]hept-2-enoate.
| Compound Name | ethyl (E,5S)-5-(methoxymethoxy)-7-[4-(methoxymethoxy)phenyl]hept-2-enoate |
|---|---|
| PubChem CID | 101492834 |
| Molecular Formula | C19H28O6 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.19 |
| IUPAC Name | ethyl (E,5S)-5-(methoxymethoxy)-7-[4-(methoxymethoxy)phenyl]hept-2-enoate |
| SMILES | CCOC(=O)/C=C/C[C@H](CCc1ccc(OCOC)cc1)OCOC |
| InChI | InChI=1S/C19H28O6/c1-4-23-19(20)7-5-6-17(24-14-21-2)11-8-16-9-12-18(13-10-16)25-15-22-3/h5,7,9-10,12-13,17H,4,6,8,11,14-15H2,1-3H3/b7-5+/t17-/m1/s1 |
| InChIKey | XDJDIYSVJAFIFD-QQOXCAACSA-N |
| XLogP | 3.10 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|