About [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane
[1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane (PubChem CID 101492968) has the molecular formula C17H28OS2Si
and a molecular weight of 340.63 g/mol. Its IUPAC name is [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane.
Molecular Properties
| Compound Name | [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane |
| PubChem CID | 101492968 |
| Molecular Formula | C17H28OS2Si |
| Molecular Weight | 340.63 g/mol |
| Exact Mass | 340.14 |
| IUPAC Name | [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane |
| SMILES | CSC(CCCc1ccccc1C1CO1)(SC)[Si](C)(C)C |
| InChI | InChI=1S/C17H28OS2Si/c1-19-17(20-2,21(3,4)5)12-8-10-14-9-6-7-11-15(14)16-13-18-16/h6-7,9,11,16H,8,10,12-13H2,1-5H3 |
| InChIKey | LLSKTGDSGCTZGG-UHFFFAOYSA-N |
| XLogP | 5.38 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 340.63 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane?
The IUPAC name of [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane (CID 101492968) is [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane.
What is the SMILES notation for [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane?
The canonical SMILES for [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane is CSC(CCCc1ccccc1C1CO1)(SC)[Si](C)(C)C.
What is the InChIKey of [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane?
The InChIKey is LLSKTGDSGCTZGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H28OS2Si/c1-19-17(20-2,21(3,4)5)12-8-10-14-9-6-7-11-15(14)16-13-18-16/h6-7,9,11,16H,8,10,12-13H2,1-5H3.
What are the key properties of [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane?
[1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane has a molecular weight of 340.63 g/mol, XLogP of 5.38, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1,1-bis(methylsulfanyl)-4-[2-(oxiran-2-yl)phenyl]butyl]-trimethylsilane is sourced from PubChem (CID 101492968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).