C32H58O3Si2 — CID 101492998
(5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenal (PubChem CID 101492998) has the molecular formula C32H58O3Si2 and a molecular weight of 546.99 g/mol. Its IUPAC name is (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenal.
| Compound Name | (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenal |
|---|---|
| PubChem CID | 101492998 |
| Molecular Formula | C32H58O3Si2 |
| Molecular Weight | 546.99 g/mol |
| Exact Mass | 546.39 |
| IUPAC Name | (5S,6E,8Z,11Z,14Z,16E,18R)-5,18-bis[[tert-butyl(dimethyl)silyl]oxy]icosa-6,8,11,14,16-pentaenal |
| SMILES | CC[C@H](/C=C/C=C\C/C=C\C/C=C\C=C\[C@H](CCCC=O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C32H58O3Si2/c1-12-29(34-36(8,9)31(2,3)4)25-21-19-17-15-13-14-16-18-20-22-26-30(27-23-24-28-33)35-37(10,11)32(5,6)7/h13-14,17-22,25-26,28-30H,12,15-16,23-24,27H2,1-11H3/b14-13-,19-17-,20-18-,25-21+,26-22+/t29-,30-/m1/s1 |
| InChIKey | YHZZAEZQVHXBRU-UYUVKVGTSA-N |
| XLogP | 10.11 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.99 |
| LogP ≤ 5 | 10.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|