C18H32O4Si — CID 101492999
(2Z,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)nona-2,4-dienal (PubChem CID 101492999) has the molecular formula C18H32O4Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (2Z,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)nona-2,4-dienal.
| Compound Name | (2Z,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)nona-2,4-dienal |
|---|---|
| PubChem CID | 101492999 |
| Molecular Formula | C18H32O4Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.21 |
| IUPAC Name | (2Z,4E,6S)-6-[tert-butyl(dimethyl)silyl]oxy-9-(1,3-dioxolan-2-yl)nona-2,4-dienal |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H](/C=C/C=C\C=O)CCCC1OCCO1 |
| InChI | InChI=1S/C18H32O4Si/c1-18(2,3)23(4,5)22-16(10-7-6-8-13-19)11-9-12-17-20-14-15-21-17/h6-8,10,13,16-17H,9,11-12,14-15H2,1-5H3/b8-6-,10-7+/t16-/m1/s1 |
| InChIKey | AIVPSGFAYFLJQA-HKSFZPIMSA-N |
| XLogP | 4.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|