About N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide
N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide (PubChem CID 10149311) has the molecular formula C11H6ClF2N3O
and a molecular weight of 269.64 g/mol. Its IUPAC name is N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide.
Molecular Properties
| Compound Name | N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide |
| PubChem CID | 10149311 |
| Molecular Formula | C11H6ClF2N3O |
| Molecular Weight | 269.64 g/mol |
| Exact Mass | 269.02 |
| IUPAC Name | N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide |
| SMILES | O=C(Nc1cnc(Cl)nc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C11H6ClF2N3O/c12-11-15-4-7(5-16-11)17-10(18)6-1-2-8(13)9(14)3-6/h1-5H,(H,17,18) |
| InChIKey | IIBSHMFXVWTQSJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.64 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide?
The IUPAC name of N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide (CID 10149311) is N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide.
What is the SMILES notation for N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide?
The canonical SMILES for N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide is O=C(Nc1cnc(Cl)nc1)c1ccc(F)c(F)c1.
What is the InChIKey of N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide?
The InChIKey is IIBSHMFXVWTQSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClF2N3O/c12-11-15-4-7(5-16-11)17-10(18)6-1-2-8(13)9(14)3-6/h1-5H,(H,17,18).
What are the key properties of N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide?
N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide has a molecular weight of 269.64 g/mol, XLogP of 2.66, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-chloropyrimidin-5-yl)-3,4-difluorobenzamide is sourced from PubChem (CID 10149311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).