C87H57N9 — CID 101493116
4-[4-[4-[3,5-bis[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-2,6-dipyridin-2-ylpyridine (PubChem CID 101493116) has the molecular formula C87H57N9 and a molecular weight of 1228.48 g/mol. Its IUPAC name is 4-[4-[4-[3,5-bis[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-2,6-dipyridin-2-ylpyridine.
| Compound Name | 4-[4-[4-[3,5-bis[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
|---|---|
| PubChem CID | 101493116 |
| Molecular Formula | C87H57N9 |
| Molecular Weight | 1228.48 g/mol |
| Exact Mass | 1227.47 |
| IUPAC Name | 4-[4-[4-[3,5-bis[4-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]phenyl]phenyl]phenyl]phenyl]-2,6-dipyridin-2-ylpyridine |
| SMILES | c1ccc(-c2cc(-c3ccc(-c4ccc(-c5cc(-c6ccc(-c7ccc(-c8cc(-c9ccccn9)nc(-c9ccccn9)c8)cc7)cc6)cc(-c6ccc(-c7ccc(-c8cc(-c9ccccn9)nc(-c9ccccn9)c8)cc7)cc6)c5)cc4)cc3)cc(-c3ccccn3)n2)nc1 |
| InChI | InChI=1S/C87H57N9/c1-7-43-88-76(13-1)82-52-73(53-83(94-82)77-14-2-8-44-89-77)67-37-25-61(26-38-67)58-19-31-64(32-20-58)70-49-71(65-33-21-59(22-34-65)62-27-39-68(40-28-62)74-54-84(78-15-3-9-45-90-78)95-85(55-74)79-16-4-10-46-91-79)51-72(50-70)66-35-23-60(24-36-66)63-29-41-69(42-30-63)75-56-86(80-17-5-11-47-92-80)96-87(57-75)81-18-6-12-48-93-81/h1-57H |
| InChIKey | IXMWMJBVLXPCHG-UHFFFAOYSA-N |
| XLogP | 21.25 |
| TPSA | 116.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1228.48 |
| LogP ≤ 5 | 21.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |