C55H59BN2 — CID 101493327
4-[[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,4,6-tri(propan-2-yl)phenyl]boranyl]-N,N-bis(4-methylphenyl)aniline (PubChem CID 101493327) has the molecular formula C55H59BN2 and a molecular weight of 758.90 g/mol. Its IUPAC name is 4-[[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,4,6-tri(propan-2-yl)phenyl]boranyl]-N,N-bis(4-methylphenyl)aniline.
| Compound Name | 4-[[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,4,6-tri(propan-2-yl)phenyl]boranyl]-N,N-bis(4-methylphenyl)aniline |
|---|---|
| PubChem CID | 101493327 |
| Molecular Formula | C55H59BN2 |
| Molecular Weight | 758.90 g/mol |
| Exact Mass | 758.48 |
| IUPAC Name | 4-[[4-(4-methyl-N-(4-methylphenyl)anilino)phenyl]-[2,4,6-tri(propan-2-yl)phenyl]boranyl]-N,N-bis(4-methylphenyl)aniline |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(B(c3ccc(N(c4ccc(C)cc4)c4ccc(C)cc4)cc3)c3c(C(C)C)cc(C(C)C)cc3C(C)C)cc2)cc1 |
| InChI | InChI=1S/C55H59BN2/c1-37(2)44-35-53(38(3)4)55(54(36-44)39(5)6)56(45-19-31-51(32-20-45)57(47-23-11-40(7)12-24-47)48-25-13-41(8)14-26-48)46-21-33-52(34-22-46)58(49-27-15-42(9)16-28-49)50-29-17-43(10)18-30-50/h11-39H,1-10H3 |
| InChIKey | LIJONGJMOOZEKA-UHFFFAOYSA-N |
| XLogP | 13.75 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 758.90 |
| LogP ≤ 5 | 13.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|