C22H25F6NOSi — CID 101493374
[[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane (PubChem CID 101493374) has the molecular formula C22H25F6NOSi and a molecular weight of 461.52 g/mol. Its IUPAC name is [[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane.
| Compound Name | [[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
|---|---|
| PubChem CID | 101493374 |
| Molecular Formula | C22H25F6NOSi |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.16 |
| IUPAC Name | [[3,5-bis(trifluoromethyl)phenyl]-phenyl-[(2S)-pyrrolidin-2-yl]methoxy]-trimethylsilane |
| SMILES | C[Si](C)(C)OC(c1ccccc1)(c1cc(C(F)(F)F)cc(C(F)(F)F)c1)[C@@H]1CCCN1 |
| InChI | InChI=1S/C22H25F6NOSi/c1-31(2,3)30-20(19-10-7-11-29-19,15-8-5-4-6-9-15)16-12-17(21(23,24)25)14-18(13-16)22(26,27)28/h4-6,8-9,12-14,19,29H,7,10-11H2,1-3H3/t19-,20?/m0/s1 |
| InChIKey | PEVWELRCHMZWFD-XJDOXCRVSA-N |
| XLogP | 6.57 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|