C11H10N6O3 — CID 10149349
4-(1-ethyl-4-nitrobenzimidazol-2-yl)-1,2,5-oxadiazol-3-amine (PubChem CID 10149349) has the molecular formula C11H10N6O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4-(1-ethyl-4-nitrobenzimidazol-2-yl)-1,2,5-oxadiazol-3-amine.
| Compound Name | 4-(1-ethyl-4-nitrobenzimidazol-2-yl)-1,2,5-oxadiazol-3-amine |
|---|---|
| PubChem CID | 10149349 |
| Molecular Formula | C11H10N6O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4-(1-ethyl-4-nitrobenzimidazol-2-yl)-1,2,5-oxadiazol-3-amine |
| SMILES | CCn1c(-c2nonc2N)nc2c([N+](=O)[O-])cccc21 |
| InChI | InChI=1S/C11H10N6O3/c1-2-16-6-4-3-5-7(17(18)19)8(6)13-11(16)9-10(12)15-20-14-9/h3-5H,2H2,1H3,(H2,12,15) |
| InChIKey | WHWSBUIWAZHHSK-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 125.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|