About [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate
[4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate (PubChem CID 101493720) has the molecular formula C18H25F3O3S
and a molecular weight of 378.46 g/mol. Its IUPAC name is [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate.
Molecular Properties
| Compound Name | [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate |
| PubChem CID | 101493720 |
| Molecular Formula | C18H25F3O3S |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.15 |
| IUPAC Name | [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate |
| SMILES | CC(C)=C(C)CCC(C)(C)c1cc(C)ccc1OS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C18H25F3O3S/c1-12(2)14(4)9-10-17(5,6)15-11-13(3)7-8-16(15)24-25(22,23)18(19,20)21/h7-8,11H,9-10H2,1-6H3 |
| InChIKey | XTLORUDWODOKCE-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate?
The IUPAC name of [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate (CID 101493720) is [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate.
What is the SMILES notation for [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate?
The canonical SMILES for [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate is CC(C)=C(C)CCC(C)(C)c1cc(C)ccc1OS(=O)(=O)C(F)(F)F.
What is the InChIKey of [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate?
The InChIKey is XTLORUDWODOKCE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H25F3O3S/c1-12(2)14(4)9-10-17(5,6)15-11-13(3)7-8-16(15)24-25(22,23)18(19,20)21/h7-8,11H,9-10H2,1-6H3.
What are the key properties of [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate?
[4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate has a molecular weight of 378.46 g/mol, XLogP of 5.64, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [4-methyl-2-(2,5,6-trimethylhept-5-en-2-yl)phenyl] trifluoromethanesulfonate is sourced from PubChem (CID 101493720), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).