About (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile
(E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile (PubChem CID 101494131) has the molecular formula C36H26N2S2
and a molecular weight of 550.75 g/mol. Its IUPAC name is (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile.
Molecular Properties
| Compound Name | (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile |
| PubChem CID | 101494131 |
| Molecular Formula | C36H26N2S2 |
| Molecular Weight | 550.75 g/mol |
| Exact Mass | 550.15 |
| IUPAC Name | (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile |
| SMILES | Cc1c2ccccc2c(CS/C(C#N)=C(\C#N)SCc2c3ccccc3c(C)c3ccccc23)c2ccccc12 |
| InChI | InChI=1S/C36H26N2S2/c1-23-25-11-3-7-15-29(25)33(30-16-8-4-12-26(23)30)21-39-35(19-37)36(20-38)40-22-34-31-17-9-5-13-27(31)24(2)28-14-6-10-18-32(28)34/h3-18H,21-22H2,1-2H3/b36-35+ |
| InChIKey | YRHQWTLCRQKVQO-ULDVOPSXSA-N |
| XLogP | 10.34 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 550.75 |
| LogP ≤ 5 | 10.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile?
The IUPAC name of (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile (CID 101494131) is (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile.
What is the SMILES notation for (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile?
The canonical SMILES for (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile is Cc1c2ccccc2c(CS/C(C#N)=C(\C#N)SCc2c3ccccc3c(C)c3ccccc23)c2ccccc12.
What is the InChIKey of (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile?
The InChIKey is YRHQWTLCRQKVQO-ULDVOPSXSA-N. The full InChI is InChI=1S/C36H26N2S2/c1-23-25-11-3-7-15-29(25)33(30-16-8-4-12-26(23)30)21-39-35(19-37)36(20-38)40-22-34-31-17-9-5-13-27(31)24(2)28-14-6-10-18-32(28)34/h3-18H,21-22H2,1-2H3/b36-35+.
What are the key properties of (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile?
(E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile has a molecular weight of 550.75 g/mol, XLogP of 10.34, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-2,3-bis[(10-methylanthracen-9-yl)methylsulfanyl]but-2-enedinitrile is sourced from PubChem (CID 101494131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).