C20H27N3O2 — CID 101494737
(4S,9aS)-3-(cyclohexylmethyl)-4-phenyl-2,4,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]triazepine-1,5-dione (PubChem CID 101494737) has the molecular formula C20H27N3O2 and a molecular weight of 341.45 g/mol. Its IUPAC name is (4S,9aS)-3-(cyclohexylmethyl)-4-phenyl-2,4,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]triazepine-1,5-dione.
| Compound Name | (4S,9aS)-3-(cyclohexylmethyl)-4-phenyl-2,4,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]triazepine-1,5-dione |
|---|---|
| PubChem CID | 101494737 |
| Molecular Formula | C20H27N3O2 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.21 |
| IUPAC Name | (4S,9aS)-3-(cyclohexylmethyl)-4-phenyl-2,4,7,8,9,9a-hexahydropyrrolo[2,1-d][1,2,5]triazepine-1,5-dione |
| SMILES | O=C1NN(CC2CCCCC2)[C@@H](c2ccccc2)C(=O)N2CCC[C@@H]12 |
| InChI | InChI=1S/C20H27N3O2/c24-19-17-12-7-13-22(17)20(25)18(16-10-5-2-6-11-16)23(21-19)14-15-8-3-1-4-9-15/h2,5-6,10-11,15,17-18H,1,3-4,7-9,12-14H2,(H,21,24)/t17-,18-/m0/s1 |
| InChIKey | BNWQUTGBNDMMRI-ROUUACIJSA-N |
| XLogP | 2.65 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |