C25H25N3OS — CID 101494792
N-[(4-methoxyphenyl)methyl]-8-phenyl-6-thia-2,4-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4,7-tetraen-5-amine (PubChem CID 101494792) has the molecular formula C25H25N3OS and a molecular weight of 415.56 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)methyl]-8-phenyl-6-thia-2,4-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4,7-tetraen-5-amine.
| Compound Name | N-[(4-methoxyphenyl)methyl]-8-phenyl-6-thia-2,4-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4,7-tetraen-5-amine |
|---|---|
| PubChem CID | 101494792 |
| Molecular Formula | C25H25N3OS |
| Molecular Weight | 415.56 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | N-[(4-methoxyphenyl)methyl]-8-phenyl-6-thia-2,4-diazatricyclo[7.5.0.03,7]tetradeca-1(9),2,4,7-tetraen-5-amine |
| SMILES | COc1ccc(CNc2nc3nc4c(c(-c5ccccc5)c3s2)CCCCC4)cc1 |
| InChI | InChI=1S/C25H25N3OS/c1-29-19-14-12-17(13-15-19)16-26-25-28-24-23(30-25)22(18-8-4-2-5-9-18)20-10-6-3-7-11-21(20)27-24/h2,4-5,8-9,12-15H,3,6-7,10-11,16H2,1H3,(H,26,27,28) |
| InChIKey | PUGBZUDRZNMCAW-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |