C19H18N4O3S — CID 101494794
4-[8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-yl]morpholine (PubChem CID 101494794) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 4-[8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-yl]morpholine.
| Compound Name | 4-[8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-yl]morpholine |
|---|---|
| PubChem CID | 101494794 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 4-[8-(4-nitrophenyl)-6-thia-2,4-diazatricyclo[7.3.0.03,7]dodeca-1(9),2,4,7-tetraen-5-yl]morpholine |
| SMILES | O=[N+]([O-])c1ccc(-c2c3c(nc4nc(N5CCOCC5)sc24)CCC3)cc1 |
| InChI | InChI=1S/C19H18N4O3S/c24-23(25)13-6-4-12(5-7-13)16-14-2-1-3-15(14)20-18-17(16)27-19(21-18)22-8-10-26-11-9-22/h4-7H,1-3,8-11H2 |
| InChIKey | FUINBRSYAATRLQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 81.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|