About 3-bromo-N-cyclopropyl-2,4-difluoroaniline
3-bromo-N-cyclopropyl-2,4-difluoroaniline (PubChem CID 101495757) has the molecular formula C9H8BrF2N
and a molecular weight of 248.07 g/mol. Its IUPAC name is 3-bromo-N-cyclopropyl-2,4-difluoroaniline.
Molecular Properties
| Compound Name | 3-bromo-N-cyclopropyl-2,4-difluoroaniline |
| PubChem CID | 101495757 |
| Molecular Formula | C9H8BrF2N |
| Molecular Weight | 248.07 g/mol |
| Exact Mass | 246.98 |
| IUPAC Name | 3-bromo-N-cyclopropyl-2,4-difluoroaniline |
| SMILES | Fc1ccc(NC2CC2)c(F)c1Br |
| InChI | InChI=1S/C9H8BrF2N/c10-8-6(11)3-4-7(9(8)12)13-5-1-2-5/h3-5,13H,1-2H2 |
| InChIKey | ICEPSTMDWQFJRG-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.07 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-N-cyclopropyl-2,4-difluoroaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-N-cyclopropyl-2,4-difluoroaniline?
The IUPAC name of 3-bromo-N-cyclopropyl-2,4-difluoroaniline (CID 101495757) is 3-bromo-N-cyclopropyl-2,4-difluoroaniline.
What is the SMILES notation for 3-bromo-N-cyclopropyl-2,4-difluoroaniline?
The canonical SMILES for 3-bromo-N-cyclopropyl-2,4-difluoroaniline is Fc1ccc(NC2CC2)c(F)c1Br.
What is the InChIKey of 3-bromo-N-cyclopropyl-2,4-difluoroaniline?
The InChIKey is ICEPSTMDWQFJRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8BrF2N/c10-8-6(11)3-4-7(9(8)12)13-5-1-2-5/h3-5,13H,1-2H2.
What are the key properties of 3-bromo-N-cyclopropyl-2,4-difluoroaniline?
3-bromo-N-cyclopropyl-2,4-difluoroaniline has a molecular weight of 248.07 g/mol, XLogP of 3.30, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-N-cyclopropyl-2,4-difluoroaniline is sourced from PubChem (CID 101495757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).