About CID 101495850
CID 101495850 (PubChem CID 101495850) has the molecular formula C21H43GeO2Si2
and a molecular weight of 456.36 g/mol.
Molecular Properties
| Compound Name | CID 101495850 |
| PubChem CID | 101495850 |
| Molecular Formula | C21H43GeO2Si2 |
| Molecular Weight | 456.36 g/mol |
| Exact Mass | 457.20 |
| IUPAC Name | — |
| SMILES | CC1=C(C)C[C@@](O[Si](C)(C)C)(C(C)(C)C)[Ge](C/C=C(\C)O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C21H43GeO2Si2/c1-17-15-21(20(4,5)6,24-26(10,11)12)22(16-18(17)2)14-13-19(3)23-25(7,8)9/h13H,14-16H2,1-12H3/b19-13+/t21-/m1/s1 |
| InChIKey | LPSRNDLTLCWWQA-UBXANZILSA-N |
| XLogP | 7.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 456.36 |
| LogP ≤ 5 | 7.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze CID 101495850 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 101495850?
The IUPAC name of CID 101495850 (CID 101495850) is not available.
What is the SMILES notation for CID 101495850?
The canonical SMILES for CID 101495850 is CC1=C(C)C[C@@](O[Si](C)(C)C)(C(C)(C)C)[Ge](C/C=C(\C)O[Si](C)(C)C)C1.
What is the InChIKey of CID 101495850?
The InChIKey is LPSRNDLTLCWWQA-UBXANZILSA-N. The full InChI is InChI=1S/C21H43GeO2Si2/c1-17-15-21(20(4,5)6,24-26(10,11)12)22(16-18(17)2)14-13-19(3)23-25(7,8)9/h13H,14-16H2,1-12H3/b19-13+/t21-/m1/s1.
What are the key properties of CID 101495850?
CID 101495850 has a molecular weight of 456.36 g/mol, XLogP of 7.15, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 101495850 is sourced from PubChem (CID 101495850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).