About 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid
9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid (PubChem CID 101495894) has the molecular formula C15H28O5Si
and a molecular weight of 316.47 g/mol. Its IUPAC name is 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid.
Molecular Properties
| Compound Name | 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid |
| PubChem CID | 101495894 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCCCC#CC(O)C(O)CC(=O)O |
| InChI | InChI=1S/C15H28O5Si/c1-15(2,3)21(4,5)20-10-8-6-7-9-12(16)13(17)11-14(18)19/h12-13,16-17H,6,8,10-11H2,1-5H3,(H,18,19) |
| InChIKey | BIVSLQPZGMINQP-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid?
The IUPAC name of 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid (CID 101495894) is 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid.
What is the SMILES notation for 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid?
The canonical SMILES for 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid is CC(C)(C)[Si](C)(C)OCCCC#CC(O)C(O)CC(=O)O.
What is the InChIKey of 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid?
The InChIKey is BIVSLQPZGMINQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H28O5Si/c1-15(2,3)21(4,5)20-10-8-6-7-9-12(16)13(17)11-14(18)19/h12-13,16-17H,6,8,10-11H2,1-5H3,(H,18,19).
What are the key properties of 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid?
9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid has a molecular weight of 316.47 g/mol, XLogP of 1.99, 7 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-[tert-butyl(dimethyl)silyl]oxy-3,4-dihydroxynon-5-ynoic acid is sourced from PubChem (CID 101495894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).