C13H17NO3 — CID 101496392
3-[2-(4-methoxyphenyl)ethyl]-1,3-oxazinan-2-one (PubChem CID 101496392) has the molecular formula C13H17NO3 and a molecular weight of 235.28 g/mol. Its IUPAC name is 3-[2-(4-methoxyphenyl)ethyl]-1,3-oxazinan-2-one.
| Compound Name | 3-[2-(4-methoxyphenyl)ethyl]-1,3-oxazinan-2-one |
|---|---|
| PubChem CID | 101496392 |
| Molecular Formula | C13H17NO3 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.12 |
| IUPAC Name | 3-[2-(4-methoxyphenyl)ethyl]-1,3-oxazinan-2-one |
| SMILES | COc1ccc(CCN2CCCOC2=O)cc1 |
| InChI | InChI=1S/C13H17NO3/c1-16-12-5-3-11(4-6-12)7-9-14-8-2-10-17-13(14)15/h3-6H,2,7-10H2,1H3 |
| InChIKey | PDLHRPBXBUGREJ-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |