C14H30OS5Si — CID 101496566
[1-(1,3-dithian-2-yl)-4,4,4-tris(methylsulfanyl)butan-2-yl]oxy-trimethylsilane (PubChem CID 101496566) has the molecular formula C14H30OS5Si and a molecular weight of 402.81 g/mol. Its IUPAC name is [1-(1,3-dithian-2-yl)-4,4,4-tris(methylsulfanyl)butan-2-yl]oxy-trimethylsilane.
| Compound Name | [1-(1,3-dithian-2-yl)-4,4,4-tris(methylsulfanyl)butan-2-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 101496566 |
| Molecular Formula | C14H30OS5Si |
| Molecular Weight | 402.81 g/mol |
| Exact Mass | 402.07 |
| IUPAC Name | [1-(1,3-dithian-2-yl)-4,4,4-tris(methylsulfanyl)butan-2-yl]oxy-trimethylsilane |
| SMILES | CSC(CC(CC1SCCCS1)O[Si](C)(C)C)(SC)SC |
| InChI | InChI=1S/C14H30OS5Si/c1-16-14(17-2,18-3)11-12(15-21(4,5)6)10-13-19-8-7-9-20-13/h12-13H,7-11H2,1-6H3 |
| InChIKey | IJYVOJLDNFPNFT-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.81 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|