C9H21N3 — CID 101496676
2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide (PubChem CID 101496676) has the molecular formula C9H21N3 and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide.
| Compound Name | 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide |
|---|---|
| PubChem CID | 101496676 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide |
| SMILES | CNC/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C9H21N3/c1-7(2)11-9(6-10-5)12-8(3)4/h7-8,10H,6H2,1-5H3,(H,11,12) |
| InChIKey | YTKIUPANKLNFNO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|