About 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide
2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide (PubChem CID 101496676) has the molecular formula C9H21N3
and a molecular weight of 171.29 g/mol. Its IUPAC name is 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide.
Molecular Properties
| Compound Name | 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide |
| PubChem CID | 101496676 |
| Molecular Formula | C9H21N3 |
| Molecular Weight | 171.29 g/mol |
| Exact Mass | 171.17 |
| IUPAC Name | 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide |
| SMILES | CNC/C(=N\C(C)C)NC(C)C |
| InChI | InChI=1S/C9H21N3/c1-7(2)11-9(6-10-5)12-8(3)4/h7-8,10H,6H2,1-5H3,(H,11,12) |
| InChIKey | YTKIUPANKLNFNO-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 36.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.29 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide?
The IUPAC name of 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide (CID 101496676) is 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide.
What is the SMILES notation for 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide?
The canonical SMILES for 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide is CNC/C(=N\C(C)C)NC(C)C.
What is the InChIKey of 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide?
The InChIKey is YTKIUPANKLNFNO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H21N3/c1-7(2)11-9(6-10-5)12-8(3)4/h7-8,10H,6H2,1-5H3,(H,11,12).
What are the key properties of 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide?
2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide has a molecular weight of 171.29 g/mol, XLogP of 1.01, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)-N,N'-di(propan-2-yl)ethanimidamide is sourced from PubChem (CID 101496676), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).