About 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide
2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide (PubChem CID 101496940) has the molecular formula C11H7N3OS4
and a molecular weight of 325.47 g/mol. Its IUPAC name is 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide.
Molecular Properties
| Compound Name | 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide |
| PubChem CID | 101496940 |
| Molecular Formula | C11H7N3OS4 |
| Molecular Weight | 325.47 g/mol |
| Exact Mass | 324.95 |
| IUPAC Name | 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide |
| SMILES | O=C(Nc1cncnc1)C1=CSC(=C2SC=CS2)S1 |
| InChI | InChI=1S/C11H7N3OS4/c15-9(14-7-3-12-6-13-4-7)8-5-18-11(19-8)10-16-1-2-17-10/h1-6H,(H,14,15) |
| InChIKey | DIHWDUCHFZNOGZ-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.47 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide?
The IUPAC name of 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide (CID 101496940) is 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide.
What is the SMILES notation for 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide?
The canonical SMILES for 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide is O=C(Nc1cncnc1)C1=CSC(=C2SC=CS2)S1.
What is the InChIKey of 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide?
The InChIKey is DIHWDUCHFZNOGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N3OS4/c15-9(14-7-3-12-6-13-4-7)8-5-18-11(19-8)10-16-1-2-17-10/h1-6H,(H,14,15).
What are the key properties of 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide?
2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide has a molecular weight of 325.47 g/mol, XLogP of 3.81, 2 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dithiol-2-ylidene)-N-pyrimidin-5-yl-1,3-dithiole-4-carboxamide is sourced from PubChem (CID 101496940), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).