C20H18N2O — CID 101497153
(4aR,8aS)-2,4-diphenyl-4a,5,8,8a-tetrahydrophthalazin-1-one (PubChem CID 101497153) has the molecular formula C20H18N2O and a molecular weight of 302.38 g/mol. Its IUPAC name is (4aR,8aS)-2,4-diphenyl-4a,5,8,8a-tetrahydrophthalazin-1-one.
| Compound Name | (4aR,8aS)-2,4-diphenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
|---|---|
| PubChem CID | 101497153 |
| Molecular Formula | C20H18N2O |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | (4aR,8aS)-2,4-diphenyl-4a,5,8,8a-tetrahydrophthalazin-1-one |
| SMILES | O=C1[C@H]2CC=CC[C@H]2C(c2ccccc2)=NN1c1ccccc1 |
| InChI | InChI=1S/C20H18N2O/c23-20-18-14-8-7-13-17(18)19(15-9-3-1-4-10-15)21-22(20)16-11-5-2-6-12-16/h1-12,17-18H,13-14H2/t17-,18+/m1/s1 |
| InChIKey | LZOKBEGFJXPSKY-MSOLQXFVSA-N |
| XLogP | 4.02 |
| TPSA | 32.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|