C17H19NO3 — CID 101497272
(2S,3S,6S)-3-hydroxy-4-methoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),4,13,15-tetraen-9-one (PubChem CID 101497272) has the molecular formula C17H19NO3 and a molecular weight of 285.34 g/mol. Its IUPAC name is (2S,3S,6S)-3-hydroxy-4-methoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),4,13,15-tetraen-9-one.
| Compound Name | (2S,3S,6S)-3-hydroxy-4-methoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),4,13,15-tetraen-9-one |
|---|---|
| PubChem CID | 101497272 |
| Molecular Formula | C17H19NO3 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | (2S,3S,6S)-3-hydroxy-4-methoxy-10-azatetracyclo[11.4.0.02,6.06,10]heptadeca-1(17),4,13,15-tetraen-9-one |
| SMILES | COC1=C[C@@]23CCC(=O)N2CCc2ccccc2[C@@H]3[C@@H]1O |
| InChI | InChI=1S/C17H19NO3/c1-21-13-10-17-8-6-14(19)18(17)9-7-11-4-2-3-5-12(11)15(17)16(13)20/h2-5,10,15-16,20H,6-9H2,1H3/t15-,16-,17-/m1/s1 |
| InChIKey | XHDPBVFMYPCKPL-BRWVUGGUSA-N |
| XLogP | 1.59 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |