About S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate
S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate (PubChem CID 101497381) has the molecular formula C23H24OSSi
and a molecular weight of 376.60 g/mol. Its IUPAC name is S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate.
Molecular Properties
| Compound Name | S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
| PubChem CID | 101497381 |
| Molecular Formula | C23H24OSSi |
| Molecular Weight | 376.60 g/mol |
| Exact Mass | 376.13 |
| IUPAC Name | S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate |
| SMILES | CC(=O)Sc1ccc(C#Cc2c(C)cc(C#C[Si](C)(C)C)cc2C)cc1 |
| InChI | InChI=1S/C23H24OSSi/c1-17-15-21(13-14-26(4,5)6)16-18(2)23(17)12-9-20-7-10-22(11-8-20)25-19(3)24/h7-8,10-11,15-16H,1-6H3 |
| InChIKey | YWYKFRDSLLCIFU-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.60 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate?
The IUPAC name of S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate (CID 101497381) is S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate.
What is the SMILES notation for S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate?
The canonical SMILES for S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate is CC(=O)Sc1ccc(C#Cc2c(C)cc(C#C[Si](C)(C)C)cc2C)cc1.
What is the InChIKey of S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate?
The InChIKey is YWYKFRDSLLCIFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H24OSSi/c1-17-15-21(13-14-26(4,5)6)16-18(2)23(17)12-9-20-7-10-22(11-8-20)25-19(3)24/h7-8,10-11,15-16H,1-6H3.
What are the key properties of S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate?
S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate has a molecular weight of 376.60 g/mol, XLogP of 5.57, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for S-[4-[2-[2,6-dimethyl-4-(2-trimethylsilylethynyl)phenyl]ethynyl]phenyl] ethanethioate is sourced from PubChem (CID 101497381), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).