C21H25N3 — CID 10149745
3-heptyl-1,5-diphenyl-1,2,4-triazole (PubChem CID 10149745) has the molecular formula C21H25N3 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-heptyl-1,5-diphenyl-1,2,4-triazole.
| Compound Name | 3-heptyl-1,5-diphenyl-1,2,4-triazole |
|---|---|
| PubChem CID | 10149745 |
| Molecular Formula | C21H25N3 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 3-heptyl-1,5-diphenyl-1,2,4-triazole |
| SMILES | CCCCCCCc1nc(-c2ccccc2)n(-c2ccccc2)n1 |
| InChI | InChI=1S/C21H25N3/c1-2-3-4-5-12-17-20-22-21(18-13-8-6-9-14-18)24(23-20)19-15-10-7-11-16-19/h6-11,13-16H,2-5,12,17H2,1H3 |
| InChIKey | AKAOFOJRQARXAA-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|