C21H18N2O4 — CID 101497530
2-[4,6-bis(4-methoxyphenoxy)-2-pyridinyl]acetonitrile (PubChem CID 101497530) has the molecular formula C21H18N2O4 and a molecular weight of 362.39 g/mol. Its IUPAC name is 2-[4,6-bis(4-methoxyphenoxy)-2-pyridinyl]acetonitrile.
| Compound Name | 2-[4,6-bis(4-methoxyphenoxy)-2-pyridinyl]acetonitrile |
|---|---|
| PubChem CID | 101497530 |
| Molecular Formula | C21H18N2O4 |
| Molecular Weight | 362.39 g/mol |
| Exact Mass | 362.13 |
| IUPAC Name | 2-[4,6-bis(4-methoxyphenoxy)-2-pyridinyl]acetonitrile |
| SMILES | COc1ccc(Oc2cc(CC#N)nc(Oc3ccc(OC)cc3)c2)cc1 |
| InChI | InChI=1S/C21H18N2O4/c1-24-16-3-7-18(8-4-16)26-20-13-15(11-12-22)23-21(14-20)27-19-9-5-17(25-2)6-10-19/h3-10,13-14H,11H2,1-2H3 |
| InChIKey | UTAWJEKZWZROME-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 73.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.39 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |