C27H50O7Si — CID 101497623
[(2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E,4S,5S)-4-(2-ethoxyethoxy)-6-hydroxy-5-methylhex-1-enyl]-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate (PubChem CID 101497623) has the molecular formula C27H50O7Si and a molecular weight of 514.78 g/mol. Its IUPAC name is [(2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E,4S,5S)-4-(2-ethoxyethoxy)-6-hydroxy-5-methylhex-1-enyl]-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E,4S,5S)-4-(2-ethoxyethoxy)-6-hydroxy-5-methylhex-1-enyl]-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 101497623 |
| Molecular Formula | C27H50O7Si |
| Molecular Weight | 514.78 g/mol |
| Exact Mass | 514.33 |
| IUPAC Name | [(2S,3S)-6-[tert-butyl(dimethyl)silyl]oxy-2-[(E,4S,5S)-4-(2-ethoxyethoxy)-6-hydroxy-5-methylhex-1-enyl]-3,6-dihydro-2H-pyran-3-yl] 2,2-dimethylpropanoate |
| SMILES | CCOCCO[C@@H](C/C=C/[C@@H]1OC(O[Si](C)(C)C(C)(C)C)C=C[C@@H]1OC(=O)C(C)(C)C)[C@@H](C)CO |
| InChI | InChI=1S/C27H50O7Si/c1-11-30-17-18-31-21(20(2)19-28)13-12-14-22-23(33-25(29)26(3,4)5)15-16-24(32-22)34-35(9,10)27(6,7)8/h12,14-16,20-24,28H,11,13,17-19H2,1-10H3/b14-12+/t20-,21-,22-,23-,24?/m0/s1 |
| InChIKey | CCKHEMKSQZIASU-VVGIGHPLSA-N |
| XLogP | 5.24 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.78 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|