C21H9F16NO — CID 101497715
2-fluoro-4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]benzonitrile (PubChem CID 101497715) has the molecular formula C21H9F16NO and a molecular weight of 595.28 g/mol. Its IUPAC name is 2-fluoro-4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]benzonitrile.
| Compound Name | 2-fluoro-4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]benzonitrile |
|---|---|
| PubChem CID | 101497715 |
| Molecular Formula | C21H9F16NO |
| Molecular Weight | 595.28 g/mol |
| Exact Mass | 595.04 |
| IUPAC Name | 2-fluoro-4-[4-(2,2,3,3,4,4,5,5,6,6,7,7,8,8,8-pentadecafluorooctoxy)phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(OCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C21H9F16NO/c22-14-7-11(1-2-12(14)8-38)10-3-5-13(6-4-10)39-9-15(23,24)16(25,26)17(27,28)18(29,30)19(31,32)20(33,34)21(35,36)37/h1-7H,9H2 |
| InChIKey | QJJGPCROXMUBSW-UHFFFAOYSA-N |
| XLogP | 8.12 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.28 |
| LogP ≤ 5 | 8.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|