C39H27O4P — CID 101497756
16-methoxy-14,18-diphenyl-10,22-dioxa-16λ5-phosphaheptacyclo[15.12.0.02,15.03,12.04,9.020,29.023,28]nonacosa-1(29),2,4,6,8,12,14,17,19,23,25,27-dodecaene 16-oxide (PubChem CID 101497756) has the molecular formula C39H27O4P and a molecular weight of 590.62 g/mol. Its IUPAC name is 16-methoxy-14,18-diphenyl-10,22-dioxa-16λ5-phosphaheptacyclo[15.12.0.02,15.03,12.04,9.020,29.023,28]nonacosa-1(29),2,4,6,8,12,14,17,19,23,25,27-dodecaene 16-oxide.
| Compound Name | 16-methoxy-14,18-diphenyl-10,22-dioxa-16λ5-phosphaheptacyclo[15.12.0.02,15.03,12.04,9.020,29.023,28]nonacosa-1(29),2,4,6,8,12,14,17,19,23,25,27-dodecaene 16-oxide |
|---|---|
| PubChem CID | 101497756 |
| Molecular Formula | C39H27O4P |
| Molecular Weight | 590.62 g/mol |
| Exact Mass | 590.16 |
| IUPAC Name | 16-methoxy-14,18-diphenyl-10,22-dioxa-16λ5-phosphaheptacyclo[15.12.0.02,15.03,12.04,9.020,29.023,28]nonacosa-1(29),2,4,6,8,12,14,17,19,23,25,27-dodecaene 16-oxide |
| SMILES | COP1(=O)c2c(-c3ccccc3)cc3c(c2-c2c4c(cc(-c5ccccc5)c21)COc1ccccc1-4)-c1ccccc1OC3 |
| InChI | InChI=1S/C39H27O4P/c1-41-44(40)38-30(24-12-4-2-5-13-24)20-26-22-42-32-18-10-8-16-28(32)34(26)36(38)37-35-27(23-43-33-19-11-9-17-29(33)35)21-31(39(37)44)25-14-6-3-7-15-25/h2-21H,22-23H2,1H3 |
| InChIKey | RTWONSRSRKYRNQ-UHFFFAOYSA-N |
| XLogP | 9.00 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.62 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|