About [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate
[(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate (PubChem CID 101497858) has the molecular formula C31H43NO5S
and a molecular weight of 541.75 g/mol. Its IUPAC name is [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate.
Molecular Properties
| Compound Name | [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate |
| PubChem CID | 101497858 |
| Molecular Formula | C31H43NO5S |
| Molecular Weight | 541.75 g/mol |
| Exact Mass | 541.29 |
| IUPAC Name | [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate |
| SMILES | CCCCCCCCCC/C=C1\CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1OC(=O)COCc1ccccc1 |
| InChI | InChI=1S/C31H43NO5S/c1-3-4-5-6-7-8-9-10-14-17-28-22-32(38(34,35)29-20-18-26(2)19-21-29)23-30(28)37-31(33)25-36-24-27-15-12-11-13-16-27/h11-13,15-21,30H,3-10,14,22-25H2,1-2H3/b28-17+/t30-/m0/s1 |
| InChIKey | DQROGMPDKJDDHR-UAMLYEQYSA-N |
| XLogP | 6.59 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 541.75 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate?
The IUPAC name of [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate (CID 101497858) is [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate.
What is the SMILES notation for [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate?
The canonical SMILES for [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate is CCCCCCCCCC/C=C1\CN(S(=O)(=O)c2ccc(C)cc2)C[C@@H]1OC(=O)COCc1ccccc1.
What is the InChIKey of [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate?
The InChIKey is DQROGMPDKJDDHR-UAMLYEQYSA-N. The full InChI is InChI=1S/C31H43NO5S/c1-3-4-5-6-7-8-9-10-14-17-28-22-32(38(34,35)29-20-18-26(2)19-21-29)23-30(28)37-31(33)25-36-24-27-15-12-11-13-16-27/h11-13,15-21,30H,3-10,14,22-25H2,1-2H3/b28-17+/t30-/m0/s1.
What are the key properties of [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate?
[(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate has a molecular weight of 541.75 g/mol, XLogP of 6.59, 16 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(3R,4E)-1-(4-methylphenyl)sulfonyl-4-undecylidenepyrrolidin-3-yl] 2-phenylmethoxyacetate is sourced from PubChem (CID 101497858), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).